C19H15Cl3F3NO5 — CID 22318624
3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]benzoic acid (PubChem CID 22318624) has the molecular formula C19H15Cl3F3NO5 and a molecular weight of 500.68 g/mol. Its IUPAC name is 3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]benzoic acid.
| Compound Name | 3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]benzoic acid |
|---|---|
| PubChem CID | 22318624 |
| Molecular Formula | C19H15Cl3F3NO5 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | 3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]benzoic acid |
| SMILES | O=C(O)c1cc(OCC=C(Cl)Cl)cc(Cl)c1OCCCOc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H15Cl3F3NO5/c20-14-9-12(29-7-4-15(21)22)8-13(18(27)28)17(14)31-6-1-5-30-16-3-2-11(10-26-16)19(23,24)25/h2-4,8-10H,1,5-7H2,(H,27,28) |
| InChIKey | HYYAENRKTKPTPX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|