C18H16Cl4O3 — CID 54077529
1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-(3-phenoxypropoxy)benzene (PubChem CID 54077529) has the molecular formula C18H16Cl4O3 and a molecular weight of 422.14 g/mol. Its IUPAC name is 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-(3-phenoxypropoxy)benzene.
| Compound Name | 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-(3-phenoxypropoxy)benzene |
|---|---|
| PubChem CID | 54077529 |
| Molecular Formula | C18H16Cl4O3 |
| Molecular Weight | 422.14 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-(3-phenoxypropoxy)benzene |
| SMILES | ClC(Cl)=CCOc1cc(Cl)c(OCCCOc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl4O3/c19-15-11-14(24-10-7-17(21)22)12-16(20)18(15)25-9-4-8-23-13-5-2-1-3-6-13/h1-3,5-7,11-12H,4,8-10H2 |
| InChIKey | MKTLLVOYEAMXKH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.14 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|