C23H25Cl4NO4 — CID 22963742
N-[4-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]phenoxy]propan-2-imine (PubChem CID 22963742) has the molecular formula C23H25Cl4NO4 and a molecular weight of 521.27 g/mol. Its IUPAC name is N-[4-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]phenoxy]propan-2-imine.
| Compound Name | N-[4-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]phenoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963742 |
| Molecular Formula | C23H25Cl4NO4 |
| Molecular Weight | 521.27 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | N-[4-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]phenoxy]propan-2-imine |
| SMILES | CC(C)=NOc1ccc(OCCCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H25Cl4NO4/c1-16(2)28-32-18-8-6-17(7-9-18)29-11-4-3-5-12-31-23-20(24)14-19(15-21(23)25)30-13-10-22(26)27/h6-10,14-15H,3-5,11-13H2,1-2H3 |
| InChIKey | VKYSFQXLGRUTJY-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.27 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|