C17H21Cl3FNO3 — CID 23379674
N-[5-[2,6-dichloro-4-[(E)-3-chloro-3-fluoroprop-2-enoxy]phenoxy]pentoxy]propan-2-imine (PubChem CID 23379674) has the molecular formula C17H21Cl3FNO3 and a molecular weight of 412.72 g/mol. Its IUPAC name is N-[5-[2,6-dichloro-4-[(E)-3-chloro-3-fluoroprop-2-enoxy]phenoxy]pentoxy]propan-2-imine.
| Compound Name | N-[5-[2,6-dichloro-4-[(E)-3-chloro-3-fluoroprop-2-enoxy]phenoxy]pentoxy]propan-2-imine |
|---|---|
| PubChem CID | 23379674 |
| Molecular Formula | C17H21Cl3FNO3 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[5-[2,6-dichloro-4-[(E)-3-chloro-3-fluoroprop-2-enoxy]phenoxy]pentoxy]propan-2-imine |
| SMILES | CC(C)=NOCCCCCOc1c(Cl)cc(OC/C=C(\F)Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl3FNO3/c1-12(2)22-25-8-5-3-4-7-24-17-14(18)10-13(11-15(17)19)23-9-6-16(20)21/h6,10-11H,3-5,7-9H2,1-2H3/b16-6- |
| InChIKey | QXQIOIUGIDKUPP-SOFYXZRVSA-N |
| XLogP | 6.38 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|