C22H32Cl2FNO3 — CID 22964033
N-[7-[2-chloro-4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-6-propylphenoxy]heptoxy]propan-2-imine (PubChem CID 22964033) has the molecular formula C22H32Cl2FNO3 and a molecular weight of 448.41 g/mol. Its IUPAC name is N-[7-[2-chloro-4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-6-propylphenoxy]heptoxy]propan-2-imine.
| Compound Name | N-[7-[2-chloro-4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-6-propylphenoxy]heptoxy]propan-2-imine |
|---|---|
| PubChem CID | 22964033 |
| Molecular Formula | C22H32Cl2FNO3 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[7-[2-chloro-4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-6-propylphenoxy]heptoxy]propan-2-imine |
| SMILES | CCCc1cc(OC/C=C(\F)Cl)cc(Cl)c1OCCCCCCCON=C(C)C |
| InChI | InChI=1S/C22H32Cl2FNO3/c1-4-10-18-15-19(27-14-11-21(24)25)16-20(23)22(18)28-12-8-6-5-7-9-13-29-26-17(2)3/h11,15-16H,4-10,12-14H2,1-3H3/b21-11- |
| InChIKey | FOJBCAUEACQOEN-NHDPSOOVSA-N |
| XLogP | 7.46 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|