C18H25ClFNO3 — CID 22963465
N-[2-[4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-2,6-diethylphenoxy]ethoxy]propan-2-imine (PubChem CID 22963465) has the molecular formula C18H25ClFNO3 and a molecular weight of 357.85 g/mol. Its IUPAC name is N-[2-[4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-2,6-diethylphenoxy]ethoxy]propan-2-imine.
| Compound Name | N-[2-[4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-2,6-diethylphenoxy]ethoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963465 |
| Molecular Formula | C18H25ClFNO3 |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[2-[4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-2,6-diethylphenoxy]ethoxy]propan-2-imine |
| SMILES | CCc1cc(OC/C=C(\F)Cl)cc(CC)c1OCCON=C(C)C |
| InChI | InChI=1S/C18H25ClFNO3/c1-5-14-11-16(22-8-7-17(19)20)12-15(6-2)18(14)23-9-10-24-21-13(3)4/h7,11-12H,5-6,8-10H2,1-4H3/b17-7- |
| InChIKey | FZYGBUKURZLLAN-IDUWFGFVSA-N |
| XLogP | 5.03 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|