C14H15Br2F2NO3 — CID 22963408
N-[2-[4-(3,3-dibromoprop-2-enoxy)-2,6-difluorophenoxy]ethoxy]propan-2-imine (PubChem CID 22963408) has the molecular formula C14H15Br2F2NO3 and a molecular weight of 443.08 g/mol. Its IUPAC name is N-[2-[4-(3,3-dibromoprop-2-enoxy)-2,6-difluorophenoxy]ethoxy]propan-2-imine.
| Compound Name | N-[2-[4-(3,3-dibromoprop-2-enoxy)-2,6-difluorophenoxy]ethoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963408 |
| Molecular Formula | C14H15Br2F2NO3 |
| Molecular Weight | 443.08 g/mol |
| Exact Mass | 440.94 |
| IUPAC Name | N-[2-[4-(3,3-dibromoprop-2-enoxy)-2,6-difluorophenoxy]ethoxy]propan-2-imine |
| SMILES | CC(C)=NOCCOc1c(F)cc(OCC=C(Br)Br)cc1F |
| InChI | InChI=1S/C14H15Br2F2NO3/c1-9(2)19-22-6-5-21-14-11(17)7-10(8-12(14)18)20-4-3-13(15)16/h3,7-8H,4-6H2,1-2H3 |
| InChIKey | SYZPYWZUZZFVOQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|