C16H19BrCl2FNO3 — CID 22963632
N-[4-[2-bromo-4-(3,3-dichloroprop-2-enoxy)-6-fluorophenoxy]butoxy]propan-2-imine (PubChem CID 22963632) has the molecular formula C16H19BrCl2FNO3 and a molecular weight of 443.14 g/mol. Its IUPAC name is N-[4-[2-bromo-4-(3,3-dichloroprop-2-enoxy)-6-fluorophenoxy]butoxy]propan-2-imine.
| Compound Name | N-[4-[2-bromo-4-(3,3-dichloroprop-2-enoxy)-6-fluorophenoxy]butoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963632 |
| Molecular Formula | C16H19BrCl2FNO3 |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | N-[4-[2-bromo-4-(3,3-dichloroprop-2-enoxy)-6-fluorophenoxy]butoxy]propan-2-imine |
| SMILES | CC(C)=NOCCCCOc1c(F)cc(OCC=C(Cl)Cl)cc1Br |
| InChI | InChI=1S/C16H19BrCl2FNO3/c1-11(2)21-24-7-4-3-6-23-16-13(17)9-12(10-14(16)20)22-8-5-15(18)19/h5,9-10H,3-4,6-8H2,1-2H3 |
| InChIKey | YTKMZXDATSXFNM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|