C19H26BrCl2NO3 — CID 22963635
N-[4-[2-bromo-4-(3,3-dichloroprop-2-enoxy)-6-propylphenoxy]butoxy]propan-2-imine (PubChem CID 22963635) has the molecular formula C19H26BrCl2NO3 and a molecular weight of 467.23 g/mol. Its IUPAC name is N-[4-[2-bromo-4-(3,3-dichloroprop-2-enoxy)-6-propylphenoxy]butoxy]propan-2-imine.
| Compound Name | N-[4-[2-bromo-4-(3,3-dichloroprop-2-enoxy)-6-propylphenoxy]butoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963635 |
| Molecular Formula | C19H26BrCl2NO3 |
| Molecular Weight | 467.23 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-[4-[2-bromo-4-(3,3-dichloroprop-2-enoxy)-6-propylphenoxy]butoxy]propan-2-imine |
| SMILES | CCCc1cc(OCC=C(Cl)Cl)cc(Br)c1OCCCCON=C(C)C |
| InChI | InChI=1S/C19H26BrCl2NO3/c1-4-7-15-12-16(24-11-8-18(21)22)13-17(20)19(15)25-9-5-6-10-26-23-14(2)3/h8,12-13H,4-7,9-11H2,1-3H3 |
| InChIKey | JKRYIAZJWSLNJD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.23 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|