C15H17Br4NO3 — CID 22963493
N-[3-[2,6-dibromo-4-(3,3-dibromoprop-2-enoxy)phenoxy]propoxy]propan-2-imine (PubChem CID 22963493) has the molecular formula C15H17Br4NO3 and a molecular weight of 578.92 g/mol. Its IUPAC name is N-[3-[2,6-dibromo-4-(3,3-dibromoprop-2-enoxy)phenoxy]propoxy]propan-2-imine.
| Compound Name | N-[3-[2,6-dibromo-4-(3,3-dibromoprop-2-enoxy)phenoxy]propoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963493 |
| Molecular Formula | C15H17Br4NO3 |
| Molecular Weight | 578.92 g/mol |
| Exact Mass | 574.79 |
| IUPAC Name | N-[3-[2,6-dibromo-4-(3,3-dibromoprop-2-enoxy)phenoxy]propoxy]propan-2-imine |
| SMILES | CC(C)=NOCCCOc1c(Br)cc(OCC=C(Br)Br)cc1Br |
| InChI | InChI=1S/C15H17Br4NO3/c1-10(2)20-23-6-3-5-22-15-12(16)8-11(9-13(15)17)21-7-4-14(18)19/h4,8-9H,3,5-7H2,1-2H3 |
| InChIKey | WCSHQTXKUWZHJW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|