C17H22Br2FNO3 — CID 22963690
N-[4-[4-(3,3-dibromoprop-2-enoxy)-2-fluoro-6-methylphenoxy]butoxy]propan-2-imine (PubChem CID 22963690) has the molecular formula C17H22Br2FNO3 and a molecular weight of 467.17 g/mol. Its IUPAC name is N-[4-[4-(3,3-dibromoprop-2-enoxy)-2-fluoro-6-methylphenoxy]butoxy]propan-2-imine.
| Compound Name | N-[4-[4-(3,3-dibromoprop-2-enoxy)-2-fluoro-6-methylphenoxy]butoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963690 |
| Molecular Formula | C17H22Br2FNO3 |
| Molecular Weight | 467.17 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | N-[4-[4-(3,3-dibromoprop-2-enoxy)-2-fluoro-6-methylphenoxy]butoxy]propan-2-imine |
| SMILES | CC(C)=NOCCCCOc1c(C)cc(OCC=C(Br)Br)cc1F |
| InChI | InChI=1S/C17H22Br2FNO3/c1-12(2)21-24-8-5-4-7-23-17-13(3)10-14(11-15(17)20)22-9-6-16(18)19/h6,10-11H,4-5,7-9H2,1-3H3 |
| InChIKey | UDVDHEUOVABWKI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.17 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|