C21H31Br2NO5 — CID 22964038
N-[7-[4-(3,3-dibromoprop-2-enoxy)-2,6-dimethoxyphenoxy]heptoxy]propan-2-imine (PubChem CID 22964038) has the molecular formula C21H31Br2NO5 and a molecular weight of 537.29 g/mol. Its IUPAC name is N-[7-[4-(3,3-dibromoprop-2-enoxy)-2,6-dimethoxyphenoxy]heptoxy]propan-2-imine.
| Compound Name | N-[7-[4-(3,3-dibromoprop-2-enoxy)-2,6-dimethoxyphenoxy]heptoxy]propan-2-imine |
|---|---|
| PubChem CID | 22964038 |
| Molecular Formula | C21H31Br2NO5 |
| Molecular Weight | 537.29 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | N-[7-[4-(3,3-dibromoprop-2-enoxy)-2,6-dimethoxyphenoxy]heptoxy]propan-2-imine |
| SMILES | COc1cc(OCC=C(Br)Br)cc(OC)c1OCCCCCCCON=C(C)C |
| InChI | InChI=1S/C21H31Br2NO5/c1-16(2)24-29-12-9-7-5-6-8-11-28-21-18(25-3)14-17(15-19(21)26-4)27-13-10-20(22)23/h10,14-15H,5-9,11-13H2,1-4H3 |
| InChIKey | RZRLEVMWZYWUBS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.29 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|