C20H31NO3 — CID 22963731
N-[4-(2,6-diethyl-4-prop-2-enoxyphenoxy)butoxy]propan-2-imine (PubChem CID 22963731) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is N-[4-(2,6-diethyl-4-prop-2-enoxyphenoxy)butoxy]propan-2-imine.
| Compound Name | N-[4-(2,6-diethyl-4-prop-2-enoxyphenoxy)butoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963731 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N-[4-(2,6-diethyl-4-prop-2-enoxyphenoxy)butoxy]propan-2-imine |
| SMILES | C=CCOc1cc(CC)c(OCCCCON=C(C)C)c(CC)c1 |
| InChI | InChI=1S/C20H31NO3/c1-6-11-22-19-14-17(7-2)20(18(8-3)15-19)23-12-9-10-13-24-21-16(4)5/h6,14-15H,1,7-13H2,2-5H3 |
| InChIKey | APFZECXXJZOKIY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|