C21H31Cl2NO3 — CID 23379663
N-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethyl-3-methylphenoxy]butoxy]propan-2-imine (PubChem CID 23379663) has the molecular formula C21H31Cl2NO3 and a molecular weight of 416.39 g/mol. Its IUPAC name is N-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethyl-3-methylphenoxy]butoxy]propan-2-imine.
| Compound Name | N-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethyl-3-methylphenoxy]butoxy]propan-2-imine |
|---|---|
| PubChem CID | 23379663 |
| Molecular Formula | C21H31Cl2NO3 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethyl-3-methylphenoxy]butoxy]propan-2-imine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)c(C)c(CC)c1OCCCCON=C(C)C |
| InChI | InChI=1S/C21H31Cl2NO3/c1-6-17-14-19(25-13-10-20(22)23)16(5)18(7-2)21(17)26-11-8-9-12-27-24-15(3)4/h10,14H,6-9,11-13H2,1-5H3 |
| InChIKey | LDRSWTDBIDTMHY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|