C21H31BrClNO3 — CID 22963973
N-[6-[4-[(E)-3-bromo-3-chloroprop-2-enoxy]-2-ethyl-6-methylphenoxy]hexoxy]propan-2-imine (PubChem CID 22963973) has the molecular formula C21H31BrClNO3 and a molecular weight of 460.84 g/mol. Its IUPAC name is N-[6-[4-[(E)-3-bromo-3-chloroprop-2-enoxy]-2-ethyl-6-methylphenoxy]hexoxy]propan-2-imine.
| Compound Name | N-[6-[4-[(E)-3-bromo-3-chloroprop-2-enoxy]-2-ethyl-6-methylphenoxy]hexoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963973 |
| Molecular Formula | C21H31BrClNO3 |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N-[6-[4-[(E)-3-bromo-3-chloroprop-2-enoxy]-2-ethyl-6-methylphenoxy]hexoxy]propan-2-imine |
| SMILES | CCc1cc(OC/C=C(\Cl)Br)cc(C)c1OCCCCCCON=C(C)C |
| InChI | InChI=1S/C21H31BrClNO3/c1-5-18-15-19(25-13-10-20(22)23)14-17(4)21(18)26-11-8-6-7-9-12-27-24-16(2)3/h10,14-15H,5-9,11-13H2,1-4H3/b20-10- |
| InChIKey | VTJQQYOBRCYFKC-JMIUGGIZSA-N |
| XLogP | 6.76 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|