C22H33Cl2NO3 — CID 22963826
N-[5-[4-(3,3-dichloroprop-2-enoxy)-2,3-diethyl-6-methylphenoxy]pentoxy]propan-2-imine (PubChem CID 22963826) has the molecular formula C22H33Cl2NO3 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[5-[4-(3,3-dichloroprop-2-enoxy)-2,3-diethyl-6-methylphenoxy]pentoxy]propan-2-imine.
| Compound Name | N-[5-[4-(3,3-dichloroprop-2-enoxy)-2,3-diethyl-6-methylphenoxy]pentoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963826 |
| Molecular Formula | C22H33Cl2NO3 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-[5-[4-(3,3-dichloroprop-2-enoxy)-2,3-diethyl-6-methylphenoxy]pentoxy]propan-2-imine |
| SMILES | CCc1c(OCC=C(Cl)Cl)cc(C)c(OCCCCCON=C(C)C)c1CC |
| InChI | InChI=1S/C22H33Cl2NO3/c1-6-18-19(7-2)22(17(5)15-20(18)26-14-11-21(23)24)27-12-9-8-10-13-28-25-16(3)4/h11,15H,6-10,12-14H2,1-5H3 |
| InChIKey | OLPNBTKBJWZKSM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|