C17H23Cl2NO4 — CID 173216470
2-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]ethyl N-hydroxyethanimidate (PubChem CID 173216470) has the molecular formula C17H23Cl2NO4 and a molecular weight of 376.28 g/mol. Its IUPAC name is 2-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]ethyl N-hydroxyethanimidate.
| Compound Name | 2-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]ethyl N-hydroxyethanimidate |
|---|---|
| PubChem CID | 173216470 |
| Molecular Formula | C17H23Cl2NO4 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]ethyl N-hydroxyethanimidate |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCOC(C)=NO |
| InChI | InChI=1S/C17H23Cl2NO4/c1-4-13-10-15(23-7-6-16(18)19)11-14(5-2)17(13)24-9-8-22-12(3)20-21/h6,10-11,21H,4-5,7-9H2,1-3H3 |
| InChIKey | OWOMGFCHSSVVIM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|