C21H27Cl4NO4 — CID 18429756
(E)-N-(3,3-dichloroprop-2-enoxy)-2-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]propoxy]ethanimine (PubChem CID 18429756) has the molecular formula C21H27Cl4NO4 and a molecular weight of 499.26 g/mol. Its IUPAC name is (E)-N-(3,3-dichloroprop-2-enoxy)-2-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]propoxy]ethanimine.
| Compound Name | (E)-N-(3,3-dichloroprop-2-enoxy)-2-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]propoxy]ethanimine |
|---|---|
| PubChem CID | 18429756 |
| Molecular Formula | C21H27Cl4NO4 |
| Molecular Weight | 499.26 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | (E)-N-(3,3-dichloroprop-2-enoxy)-2-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]propoxy]ethanimine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCOC/C=N/OCC=C(Cl)Cl |
| InChI | InChI=1S/C21H27Cl4NO4/c1-3-16-14-18(28-11-6-19(22)23)15-17(4-2)21(16)29-10-5-9-27-13-8-26-30-12-7-20(24)25/h6-8,14-15H,3-5,9-13H2,1-2H3/b26-8+ |
| InChIKey | GFJPRVRYZONENO-MWRNPHMMSA-N |
| XLogP | 6.62 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.26 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|