C19H27Cl2NO4 — CID 18430118
(NE)-N-[3-[4-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]butoxy]propylidene]hydroxylamine (PubChem CID 18430118) has the molecular formula C19H27Cl2NO4 and a molecular weight of 404.33 g/mol. Its IUPAC name is (NE)-N-[3-[4-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]butoxy]propylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-[4-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]butoxy]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 18430118 |
| Molecular Formula | C19H27Cl2NO4 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (NE)-N-[3-[4-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]butoxy]propylidene]hydroxylamine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(C)c1OCCCCOCC/C=N/O |
| InChI | InChI=1S/C19H27Cl2NO4/c1-3-16-14-17(25-12-7-18(20)21)13-15(2)19(16)26-11-5-4-9-24-10-6-8-22-23/h7-8,13-14,23H,3-6,9-12H2,1-2H3/b22-8+ |
| InChIKey | WNVWVGLFFRBKRO-GZIVZEMBSA-N |
| XLogP | 5.28 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|