C19H27Cl2NO4 — CID 86584396
N-[2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]ethylidene]hydroxylamine (PubChem CID 86584396) has the molecular formula C19H27Cl2NO4 and a molecular weight of 404.33 g/mol. Its IUPAC name is N-[2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]ethylidene]hydroxylamine.
| Compound Name | N-[2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 86584396 |
| Molecular Formula | C19H27Cl2NO4 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]ethylidene]hydroxylamine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCCOCC=NO |
| InChI | InChI=1S/C19H27Cl2NO4/c1-3-15-13-17(25-11-7-18(20)21)14-16(4-2)19(15)26-10-6-5-9-24-12-8-22-23/h7-8,13-14,23H,3-6,9-12H2,1-2H3 |
| InChIKey | AMMJPKIYHWHXFR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|