C24H37Cl2NO4 — CID 57280385
1-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-[(2-methylpropan-2-yl)oxy]prop-1-en-2-amine (PubChem CID 57280385) has the molecular formula C24H37Cl2NO4 and a molecular weight of 474.47 g/mol. Its IUPAC name is 1-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-[(2-methylpropan-2-yl)oxy]prop-1-en-2-amine.
| Compound Name | 1-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-[(2-methylpropan-2-yl)oxy]prop-1-en-2-amine |
|---|---|
| PubChem CID | 57280385 |
| Molecular Formula | C24H37Cl2NO4 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 1-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-[(2-methylpropan-2-yl)oxy]prop-1-en-2-amine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCCOC=C(C)NOC(C)(C)C |
| InChI | InChI=1S/C24H37Cl2NO4/c1-7-19-15-21(29-14-11-22(25)26)16-20(8-2)23(19)30-13-10-9-12-28-17-18(3)27-31-24(4,5)6/h11,15-17,27H,7-10,12-14H2,1-6H3 |
| InChIKey | NFEAYYCEBYZHGG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|