C19H23Cl4NO3 — CID 57012692
N-(3,3-dichloroprop-2-enoxy)-1-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]prop-1-en-2-amine (PubChem CID 57012692) has the molecular formula C19H23Cl4NO3 and a molecular weight of 455.21 g/mol. Its IUPAC name is N-(3,3-dichloroprop-2-enoxy)-1-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]prop-1-en-2-amine.
| Compound Name | N-(3,3-dichloroprop-2-enoxy)-1-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]prop-1-en-2-amine |
|---|---|
| PubChem CID | 57012692 |
| Molecular Formula | C19H23Cl4NO3 |
| Molecular Weight | 455.21 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | N-(3,3-dichloroprop-2-enoxy)-1-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]prop-1-en-2-amine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OC=C(C)NOCC=C(Cl)Cl |
| InChI | InChI=1S/C19H23Cl4NO3/c1-4-14-10-16(25-8-6-17(20)21)11-15(5-2)19(14)26-12-13(3)24-27-9-7-18(22)23/h6-7,10-12,24H,4-5,8-9H2,1-3H3 |
| InChIKey | WJRMSGXBGOMVTB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.21 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|