C19H22Cl3NO3 — CID 18459363
O-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]phenyl]hydroxylamine;hydrochloride (PubChem CID 18459363) has the molecular formula C19H22Cl3NO3 and a molecular weight of 418.75 g/mol. Its IUPAC name is O-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]phenyl]hydroxylamine;hydrochloride.
| Compound Name | O-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]phenyl]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 18459363 |
| Molecular Formula | C19H22Cl3NO3 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | O-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]phenyl]hydroxylamine;hydrochloride |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1Oc1cccc(ON)c1.Cl |
| InChI | InChI=1S/C19H21Cl2NO3.ClH/c1-3-13-10-17(23-9-8-18(20)21)11-14(4-2)19(13)24-15-6-5-7-16(12-15)25-22;/h5-8,10-12H,3-4,9,22H2,1-2H3;1H |
| InChIKey | SQCGAYZEULNXCY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|