C12H14Cl2FNO — CID 18725509
4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-fluoro-N-methylaniline (PubChem CID 18725509) has the molecular formula C12H14Cl2FNO and a molecular weight of 278.15 g/mol. Its IUPAC name is 4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-fluoro-N-methylaniline.
| Compound Name | 4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 18725509 |
| Molecular Formula | C12H14Cl2FNO |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-fluoro-N-methylaniline |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(F)c1NC |
| InChI | InChI=1S/C12H14Cl2FNO/c1-3-8-6-9(17-5-4-11(13)14)7-10(15)12(8)16-2/h4,6-7,16H,3,5H2,1-2H3 |
| InChIKey | KEVSGOMQMYKOCV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|