C18H15Cl5O3 — CID 54295507
1,3-dichloro-2-[3-(4-chlorophenoxy)propoxy]-5-(3,3-dichloroprop-2-enoxy)benzene (PubChem CID 54295507) has the molecular formula C18H15Cl5O3 and a molecular weight of 456.58 g/mol. Its IUPAC name is 1,3-dichloro-2-[3-(4-chlorophenoxy)propoxy]-5-(3,3-dichloroprop-2-enoxy)benzene.
| Compound Name | 1,3-dichloro-2-[3-(4-chlorophenoxy)propoxy]-5-(3,3-dichloroprop-2-enoxy)benzene |
|---|---|
| PubChem CID | 54295507 |
| Molecular Formula | C18H15Cl5O3 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | 1,3-dichloro-2-[3-(4-chlorophenoxy)propoxy]-5-(3,3-dichloroprop-2-enoxy)benzene |
| SMILES | ClC(Cl)=CCOc1cc(Cl)c(OCCCOc2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl5O3/c19-12-2-4-13(5-3-12)24-7-1-8-26-18-15(20)10-14(11-16(18)21)25-9-6-17(22)23/h2-6,10-11H,1,7-9H2 |
| InChIKey | SAMZOSXZAYJFPY-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|