C17H12Cl7NO3 — CID 141278423
2,3,5-trichloro-6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]pyridine (PubChem CID 141278423) has the molecular formula C17H12Cl7NO3 and a molecular weight of 526.46 g/mol. Its IUPAC name is 2,3,5-trichloro-6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]pyridine.
| Compound Name | 2,3,5-trichloro-6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]pyridine |
|---|---|
| PubChem CID | 141278423 |
| Molecular Formula | C17H12Cl7NO3 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 522.86 |
| IUPAC Name | 2,3,5-trichloro-6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]pyridine |
| SMILES | ClC(Cl)=CCOc1cc(Cl)c(OCCCOc2nc(Cl)c(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl7NO3/c18-10-6-9(26-5-2-14(22)23)7-11(19)15(10)27-3-1-4-28-17-13(21)8-12(20)16(24)25-17/h2,6-8H,1,3-5H2 |
| InChIKey | HIQUPPQFTVKAAT-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|