C14H18Cl3NO3 — CID 18429754
O-[4-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-methylphenoxy]butyl]hydroxylamine (PubChem CID 18429754) has the molecular formula C14H18Cl3NO3 and a molecular weight of 354.66 g/mol. Its IUPAC name is O-[4-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-methylphenoxy]butyl]hydroxylamine.
| Compound Name | O-[4-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-methylphenoxy]butyl]hydroxylamine |
|---|---|
| PubChem CID | 18429754 |
| Molecular Formula | C14H18Cl3NO3 |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | O-[4-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-methylphenoxy]butyl]hydroxylamine |
| SMILES | Cc1cc(OCC=C(Cl)Cl)cc(Cl)c1OCCCCON |
| InChI | InChI=1S/C14H18Cl3NO3/c1-10-8-11(19-7-4-13(16)17)9-12(15)14(10)20-5-2-3-6-21-18/h4,8-9H,2-3,5-7,18H2,1H3 |
| InChIKey | QDNBWFPWMNZFBA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|