C22H24Cl3NO3 — CID 18430192
(E)-N-[5-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-methylphenoxy]pentoxy]-1-phenylmethanimine (PubChem CID 18430192) has the molecular formula C22H24Cl3NO3 and a molecular weight of 456.80 g/mol. Its IUPAC name is (E)-N-[5-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-methylphenoxy]pentoxy]-1-phenylmethanimine.
| Compound Name | (E)-N-[5-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-methylphenoxy]pentoxy]-1-phenylmethanimine |
|---|---|
| PubChem CID | 18430192 |
| Molecular Formula | C22H24Cl3NO3 |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | (E)-N-[5-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-methylphenoxy]pentoxy]-1-phenylmethanimine |
| SMILES | Cc1cc(OCC=C(Cl)Cl)cc(Cl)c1OCCCCCO/N=C/c1ccccc1 |
| InChI | InChI=1S/C22H24Cl3NO3/c1-17-14-19(27-13-10-21(24)25)15-20(23)22(17)28-11-6-3-7-12-29-26-16-18-8-4-2-5-9-18/h2,4-5,8-10,14-16H,3,6-7,11-13H2,1H3/b26-16+ |
| InChIKey | AHYRFLYQEUBKKY-WGOQTCKBSA-N |
| XLogP | 6.95 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|