C20H18Cl5NO3 — CID 54482117
1-(4-chlorophenyl)-N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]methanimine (PubChem CID 54482117) has the molecular formula C20H18Cl5NO3 and a molecular weight of 497.63 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]methanimine |
|---|---|
| PubChem CID | 54482117 |
| Molecular Formula | C20H18Cl5NO3 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]methanimine |
| SMILES | ClC(Cl)=CCOc1cc(Cl)c(OCCCCON=Cc2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl5NO3/c21-15-5-3-14(4-6-15)13-26-29-9-2-1-8-28-20-17(22)11-16(12-18(20)23)27-10-7-19(24)25/h3-7,11-13H,1-2,8-10H2 |
| InChIKey | XPSNGSRZZDWKMU-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|