C18H15Cl5O3S — CID 54013640
1,3-dichloro-2-[3-(4-chlorophenyl)sulfinylpropoxy]-5-(3,3-dichloroprop-2-enoxy)benzene (PubChem CID 54013640) has the molecular formula C18H15Cl5O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is 1,3-dichloro-2-[3-(4-chlorophenyl)sulfinylpropoxy]-5-(3,3-dichloroprop-2-enoxy)benzene.
| Compound Name | 1,3-dichloro-2-[3-(4-chlorophenyl)sulfinylpropoxy]-5-(3,3-dichloroprop-2-enoxy)benzene |
|---|---|
| PubChem CID | 54013640 |
| Molecular Formula | C18H15Cl5O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | 1,3-dichloro-2-[3-(4-chlorophenyl)sulfinylpropoxy]-5-(3,3-dichloroprop-2-enoxy)benzene |
| SMILES | O=S(CCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15Cl5O3S/c19-12-2-4-14(5-3-12)27(24)9-1-7-26-18-15(20)10-13(11-16(18)21)25-8-6-17(22)23/h2-6,10-11H,1,7-9H2 |
| InChIKey | KUCCWKFLONESTQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|