C19H14Cl4F3NO3 — CID 18430098
(E)-N-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 18430098) has the molecular formula C19H14Cl4F3NO3 and a molecular weight of 503.13 g/mol. Its IUPAC name is (E)-N-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | (E)-N-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 18430098 |
| Molecular Formula | C19H14Cl4F3NO3 |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 500.97 |
| IUPAC Name | (E)-N-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1ccc(/C=N/OCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H14Cl4F3NO3/c20-15-9-14(28-6-5-17(22)23)10-16(21)18(15)29-7-8-30-27-11-12-1-3-13(4-2-12)19(24,25)26/h1-5,9-11H,6-8H2/b27-11+ |
| InChIKey | KBIOGTDAZDRKPC-LUOAPIJWSA-N |
| XLogP | 7.14 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|