C21H18Cl4F3NO3 — CID 57318232
N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine (PubChem CID 57318232) has the molecular formula C21H18Cl4F3NO3 and a molecular weight of 531.19 g/mol. Its IUPAC name is N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine.
| Compound Name | N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine |
|---|---|
| PubChem CID | 57318232 |
| Molecular Formula | C21H18Cl4F3NO3 |
| Molecular Weight | 531.19 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine |
| SMILES | C=C(NOCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18Cl4F3NO3/c1-13(14-3-5-15(6-4-14)21(26,27)28)29-32-9-2-8-31-20-17(22)11-16(12-18(20)23)30-10-7-19(24)25/h3-7,11-12,29H,1-2,8-10H2 |
| InChIKey | NCVVXOPTPYYSNG-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.19 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|