C22H23Cl4NO3 — CID 57049706
N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-1-phenylethenamine (PubChem CID 57049706) has the molecular formula C22H23Cl4NO3 and a molecular weight of 491.24 g/mol. Its IUPAC name is N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-1-phenylethenamine.
| Compound Name | N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-1-phenylethenamine |
|---|---|
| PubChem CID | 57049706 |
| Molecular Formula | C22H23Cl4NO3 |
| Molecular Weight | 491.24 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-1-phenylethenamine |
| SMILES | C=C(NOCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H23Cl4NO3/c1-16(17-8-4-2-5-9-17)27-30-12-7-3-6-11-29-22-19(23)14-18(15-20(22)24)28-13-10-21(25)26/h2,4-5,8-10,14-15,27H,1,3,6-7,11-13H2 |
| InChIKey | FPMXOZDZUAXALN-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.24 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|