C18H17Cl2F2NO2 — CID 144965311
1-[3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorophenyl]ethenamine (PubChem CID 144965311) has the molecular formula C18H17Cl2F2NO2 and a molecular weight of 388.24 g/mol. Its IUPAC name is 1-[3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorophenyl]ethenamine.
| Compound Name | 1-[3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorophenyl]ethenamine |
|---|---|
| PubChem CID | 144965311 |
| Molecular Formula | C18H17Cl2F2NO2 |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 1-[3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorophenyl]ethenamine |
| SMILES | C=C(N)c1c(F)ccc(OCCCCOc2ccc(Cl)cc2Cl)c1F |
| InChI | InChI=1S/C18H17Cl2F2NO2/c1-11(23)17-14(21)5-7-16(18(17)22)25-9-3-2-8-24-15-6-4-12(19)10-13(15)20/h4-7,10H,1-3,8-9,23H2 |
| InChIKey | SJMZAKYTMZXGAO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|