C12H14ClF2NO2 — CID 66546028
3-(5-chloropentoxy)-2,6-difluorobenzamide (PubChem CID 66546028) has the molecular formula C12H14ClF2NO2 and a molecular weight of 277.70 g/mol. Its IUPAC name is 3-(5-chloropentoxy)-2,6-difluorobenzamide.
| Compound Name | 3-(5-chloropentoxy)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 66546028 |
| Molecular Formula | C12H14ClF2NO2 |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-(5-chloropentoxy)-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(OCCCCCCl)c1F |
| InChI | InChI=1S/C12H14ClF2NO2/c13-6-2-1-3-7-18-9-5-4-8(14)10(11(9)15)12(16)17/h4-5H,1-3,6-7H2,(H2,16,17) |
| InChIKey | IZTGJGPDIQXFAS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|