C20H23BrF2N2O4 — CID 143542763
3-[2-[(E)-2-amino-1-bromo-2-(4-methoxyphenyl)ethenoxy]ethoxy]-2,6-difluorobenzamide;ethane (PubChem CID 143542763) has the molecular formula C20H23BrF2N2O4 and a molecular weight of 473.31 g/mol. Its IUPAC name is 3-[2-[(E)-2-amino-1-bromo-2-(4-methoxyphenyl)ethenoxy]ethoxy]-2,6-difluorobenzamide;ethane.
| Compound Name | 3-[2-[(E)-2-amino-1-bromo-2-(4-methoxyphenyl)ethenoxy]ethoxy]-2,6-difluorobenzamide;ethane |
|---|---|
| PubChem CID | 143542763 |
| Molecular Formula | C20H23BrF2N2O4 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 3-[2-[(E)-2-amino-1-bromo-2-(4-methoxyphenyl)ethenoxy]ethoxy]-2,6-difluorobenzamide;ethane |
| SMILES | CC.COc1ccc(/C(N)=C(\Br)OCCOc2ccc(F)c(C(N)=O)c2F)cc1 |
| InChI | InChI=1S/C18H17BrF2N2O4.C2H6/c1-25-11-4-2-10(3-5-11)16(22)17(19)27-9-8-26-13-7-6-12(20)14(15(13)21)18(23)24;1-2/h2-7H,8-9,22H2,1H3,(H2,23,24);1-2H3/b17-16-; |
| InChIKey | ZVGPAICVYUVINC-XYJRJTJESA-N |
| XLogP | 4.17 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|