C12H11F2NO4 — CID 59402682
methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate (PubChem CID 59402682) has the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. Its IUPAC name is methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate.
| Compound Name | methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate |
|---|---|
| PubChem CID | 59402682 |
| Molecular Formula | C12H11F2NO4 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate |
| SMILES | COC(=O)/C=C/COc1ccc(F)c(C(N)=O)c1F |
| InChI | InChI=1S/C12H11F2NO4/c1-18-9(16)3-2-6-19-8-5-4-7(13)10(11(8)14)12(15)17/h2-5H,6H2,1H3,(H2,15,17)/b3-2+ |
| InChIKey | VTDTZRZUEPYCMF-NSCUHMNNSA-N |
| XLogP | 1.17 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|