methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate

C12H11F2NO4 — CID 59402682

IUPACmethyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate
SMILESCOC(=O)/C=C/COc1ccc(F)c(C(N)=O)c1F
InChIInChI=1S/C12H11F2NO4/c1-18-9(16)3-2-6-19-8-5-4-7(13)10(11(8)14)12(15)17/h2-5H,6H2,1H3,(H2,15,17)/b3-2+
InChIKeyVTDTZRZUEPYCMF-NSCUHMNNSA-N
MW271.22 g/mol
LogP1.17
Rot. Bonds5

About methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate

methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate (PubChem CID 59402682) has the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. Its IUPAC name is methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate.

Molecular Properties

Compound Namemethyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate
PubChem CID59402682
Molecular FormulaC12H11F2NO4
Molecular Weight271.22 g/mol
Exact Mass271.07
IUPAC Namemethyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate
SMILESCOC(=O)/C=C/COc1ccc(F)c(C(N)=O)c1F
InChIInChI=1S/C12H11F2NO4/c1-18-9(16)3-2-6-19-8-5-4-7(13)10(11(8)14)12(15)17/h2-5H,6H2,1H3,(H2,15,17)/b3-2+
InChIKeyVTDTZRZUEPYCMF-NSCUHMNNSA-N
XLogP1.17
TPSA78.62 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.22
LogP ≤ 51.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate?
The IUPAC name of methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate (CID 59402682) is methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate.
What is the SMILES notation for methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate?
The canonical SMILES for methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate is COC(=O)/C=C/COc1ccc(F)c(C(N)=O)c1F.
What is the InChIKey of methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate?
The InChIKey is VTDTZRZUEPYCMF-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H11F2NO4/c1-18-9(16)3-2-6-19-8-5-4-7(13)10(11(8)14)12(15)17/h2-5H,6H2,1H3,(H2,15,17)/b3-2+.
What are the key properties of methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate?
methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate has a molecular weight of 271.22 g/mol, XLogP of 1.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-(3-carbamoyl-2,4-difluorophenoxy)but-2-enoate is sourced from PubChem (CID 59402682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).