C16H11F2NO2S — CID 59402891
3-(1-benzothiophen-2-ylmethoxy)-2,6-difluorobenzamide (PubChem CID 59402891) has the molecular formula C16H11F2NO2S and a molecular weight of 319.33 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-ylmethoxy)-2,6-difluorobenzamide.
| Compound Name | 3-(1-benzothiophen-2-ylmethoxy)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 59402891 |
| Molecular Formula | C16H11F2NO2S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3-(1-benzothiophen-2-ylmethoxy)-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(OCc2cc3ccccc3s2)c1F |
| InChI | InChI=1S/C16H11F2NO2S/c17-11-5-6-12(15(18)14(11)16(19)20)21-8-10-7-9-3-1-2-4-13(9)22-10/h1-7H,8H2,(H2,19,20) |
| InChIKey | ZJZPLGPPYNVNIS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |