C15H9ClF2N2O2S — CID 46237138
3-[(4-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide (PubChem CID 46237138) has the molecular formula C15H9ClF2N2O2S and a molecular weight of 354.77 g/mol. Its IUPAC name is 3-[(4-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide.
| Compound Name | 3-[(4-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 46237138 |
| Molecular Formula | C15H9ClF2N2O2S |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-[(4-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(OCc2nc3c(Cl)cccc3s2)c1F |
| InChI | InChI=1S/C15H9ClF2N2O2S/c16-7-2-1-3-10-14(7)20-11(23-10)6-22-9-5-4-8(17)12(13(9)18)15(19)21/h1-5H,6H2,(H2,19,21) |
| InChIKey | DJFNHBOOMSGIHZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |