C17H19F2NO2 — CID 143542803
2,6-difluoro-3-[(3-methylphenyl)methoxy]benzamide;ethane (PubChem CID 143542803) has the molecular formula C17H19F2NO2 and a molecular weight of 307.34 g/mol. Its IUPAC name is 2,6-difluoro-3-[(3-methylphenyl)methoxy]benzamide;ethane.
| Compound Name | 2,6-difluoro-3-[(3-methylphenyl)methoxy]benzamide;ethane |
|---|---|
| PubChem CID | 143542803 |
| Molecular Formula | C17H19F2NO2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2,6-difluoro-3-[(3-methylphenyl)methoxy]benzamide;ethane |
| SMILES | CC.Cc1cccc(COc2ccc(F)c(C(N)=O)c2F)c1 |
| InChI | InChI=1S/C15H13F2NO2.C2H6/c1-9-3-2-4-10(7-9)8-20-12-6-5-11(16)13(14(12)17)15(18)19;1-2/h2-7H,8H2,1H3,(H2,18,19);1-2H3 |
| InChIKey | MJUNFTXTLPPHBT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |