C16H13F2NO4 — CID 134137552
3-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-2,6-difluorobenzamide (PubChem CID 134137552) has the molecular formula C16H13F2NO4 and a molecular weight of 321.28 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-2,6-difluorobenzamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 134137552 |
| Molecular Formula | C16H13F2NO4 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(OCc2ccc3c(c2)OCCO3)c1F |
| InChI | InChI=1S/C16H13F2NO4/c17-10-2-4-12(15(18)14(10)16(19)20)23-8-9-1-3-11-13(7-9)22-6-5-21-11/h1-4,7H,5-6,8H2,(H2,19,20) |
| InChIKey | WKKDFALCIQPSMS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |