C13H15F2N3O2 — CID 143542927
2,6-difluoro-3-[2-[methyl-[(Z)-prop-2-enylideneamino]amino]ethoxy]benzamide (PubChem CID 143542927) has the molecular formula C13H15F2N3O2 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2,6-difluoro-3-[2-[methyl-[(Z)-prop-2-enylideneamino]amino]ethoxy]benzamide.
| Compound Name | 2,6-difluoro-3-[2-[methyl-[(Z)-prop-2-enylideneamino]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 143542927 |
| Molecular Formula | C13H15F2N3O2 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2,6-difluoro-3-[2-[methyl-[(Z)-prop-2-enylideneamino]amino]ethoxy]benzamide |
| SMILES | C=C/C=N\N(C)CCOc1ccc(F)c(C(N)=O)c1F |
| InChI | InChI=1S/C13H15F2N3O2/c1-3-6-17-18(2)7-8-20-10-5-4-9(14)11(12(10)15)13(16)19/h3-6H,1,7-8H2,2H3,(H2,16,19)/b17-6- |
| InChIKey | QRPANKIBVXQEJW-FMQZQXMHSA-N |
| XLogP | 1.55 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|