C22H19ClF2N2O3 — CID 89157321
3-[3-[4-(4-chlorophenyl)-5-prop-2-enyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide (PubChem CID 89157321) has the molecular formula C22H19ClF2N2O3 and a molecular weight of 432.85 g/mol. Its IUPAC name is 3-[3-[4-(4-chlorophenyl)-5-prop-2-enyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide.
| Compound Name | 3-[3-[4-(4-chlorophenyl)-5-prop-2-enyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 89157321 |
| Molecular Formula | C22H19ClF2N2O3 |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 3-[3-[4-(4-chlorophenyl)-5-prop-2-enyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide |
| SMILES | C=CCc1oc(CCCOc2ccc(F)c(C(N)=O)c2F)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClF2N2O3/c1-2-4-17-21(13-6-8-14(23)9-7-13)27-18(30-17)5-3-12-29-16-11-10-15(24)19(20(16)25)22(26)28/h2,6-11H,1,3-5,12H2,(H2,26,28) |
| InChIKey | KDBRCUAJESXSLQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|