C18H14F2N2O3S — CID 59402749
2,6-difluoro-3-[[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]methoxy]benzamide (PubChem CID 59402749) has the molecular formula C18H14F2N2O3S and a molecular weight of 376.38 g/mol. Its IUPAC name is 2,6-difluoro-3-[[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]methoxy]benzamide.
| Compound Name | 2,6-difluoro-3-[[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 59402749 |
| Molecular Formula | C18H14F2N2O3S |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2,6-difluoro-3-[[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]methoxy]benzamide |
| SMILES | COc1cccc(-c2csc(COc3ccc(F)c(C(N)=O)c3F)n2)c1 |
| InChI | InChI=1S/C18H14F2N2O3S/c1-24-11-4-2-3-10(7-11)13-9-26-15(22-13)8-25-14-6-5-12(19)16(17(14)20)18(21)23/h2-7,9H,8H2,1H3,(H2,21,23) |
| InChIKey | FLMMLWJFFWWSNO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |