C18H11F2N3O2S — CID 59402771
2,6-difluoro-3-[[4-(4-isocyanophenyl)-1,3-thiazol-2-yl]methoxy]benzamide (PubChem CID 59402771) has the molecular formula C18H11F2N3O2S and a molecular weight of 371.37 g/mol. Its IUPAC name is 2,6-difluoro-3-[[4-(4-isocyanophenyl)-1,3-thiazol-2-yl]methoxy]benzamide.
| Compound Name | 2,6-difluoro-3-[[4-(4-isocyanophenyl)-1,3-thiazol-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 59402771 |
| Molecular Formula | C18H11F2N3O2S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2,6-difluoro-3-[[4-(4-isocyanophenyl)-1,3-thiazol-2-yl]methoxy]benzamide |
| SMILES | [C-]#[N+]c1ccc(-c2csc(COc3ccc(F)c(C(N)=O)c3F)n2)cc1 |
| InChI | InChI=1S/C18H11F2N3O2S/c1-22-11-4-2-10(3-5-11)13-9-26-15(23-13)8-25-14-7-6-12(19)16(17(14)20)18(21)24/h2-7,9H,8H2,(H2,21,24) |
| InChIKey | YWZUSMJMQWVYFI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|