C16H17Cl4O5P — CID 67683107
bis[2-(2,4-dichlorophenoxy)ethyl]-trihydroxy-λ5-phosphane (PubChem CID 67683107) has the molecular formula C16H17Cl4O5P and a molecular weight of 462.09 g/mol. Its IUPAC name is bis[2-(2,4-dichlorophenoxy)ethyl]-trihydroxy-λ5-phosphane.
| Compound Name | bis[2-(2,4-dichlorophenoxy)ethyl]-trihydroxy-λ5-phosphane |
|---|---|
| PubChem CID | 67683107 |
| Molecular Formula | C16H17Cl4O5P |
| Molecular Weight | 462.09 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | bis[2-(2,4-dichlorophenoxy)ethyl]-trihydroxy-λ5-phosphane |
| SMILES | OP(O)(O)(CCOc1ccc(Cl)cc1Cl)CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl4O5P/c17-11-1-3-15(13(19)9-11)24-5-7-26(21,22,23)8-6-25-16-4-2-12(18)10-14(16)20/h1-4,9-10,21-23H,5-8H2 |
| InChIKey | PROGNXIKTNBFMY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.09 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|