C14H11Cl3O3 — CID 172641394
2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]ethanol (PubChem CID 172641394) has the molecular formula C14H11Cl3O3 and a molecular weight of 333.60 g/mol. Its IUPAC name is 2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]ethanol.
| Compound Name | 2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]ethanol |
|---|---|
| PubChem CID | 172641394 |
| Molecular Formula | C14H11Cl3O3 |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]ethanol |
| SMILES | OCCOc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl3O3/c15-9-1-3-12(11(17)7-9)20-13-4-2-10(16)8-14(13)19-6-5-18/h1-4,7-8,18H,5-6H2 |
| InChIKey | URWHEVKXZLYYSE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |