C13H13Cl5O3 — CID 518190
4-(2,4-dichlorophenoxy)butyl 2,2,3-trichloropropanoate (PubChem CID 518190) has the molecular formula C13H13Cl5O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)butyl 2,2,3-trichloropropanoate.
| Compound Name | 4-(2,4-dichlorophenoxy)butyl 2,2,3-trichloropropanoate |
|---|---|
| PubChem CID | 518190 |
| Molecular Formula | C13H13Cl5O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)butyl 2,2,3-trichloropropanoate |
| SMILES | O=C(OCCCCOc1ccc(Cl)cc1Cl)C(Cl)(Cl)CCl |
| InChI | InChI=1S/C13H13Cl5O3/c14-8-13(17,18)12(19)21-6-2-1-5-20-11-4-3-9(15)7-10(11)16/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | BGPDOPQNJMHBIX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|