C20H28Cl2O4 — CID 91706274
1-O-(2,4-dichlorophenyl) 3-O-heptyl 2,2-diethylpropanedioate (PubChem CID 91706274) has the molecular formula C20H28Cl2O4 and a molecular weight of 403.35 g/mol. Its IUPAC name is 1-O-(2,4-dichlorophenyl) 3-O-heptyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-(2,4-dichlorophenyl) 3-O-heptyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91706274 |
| Molecular Formula | C20H28Cl2O4 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-O-(2,4-dichlorophenyl) 3-O-heptyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCCOC(=O)C(CC)(CC)C(=O)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H28Cl2O4/c1-4-7-8-9-10-13-25-18(23)20(5-2,6-3)19(24)26-17-12-11-15(21)14-16(17)22/h11-12,14H,4-10,13H2,1-3H3 |
| InChIKey | IZCYYTYNKHHCJJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|