C22H33ClO4 — CID 91706029
1-O-(2-chloro-5-methylphenyl) 3-O-octyl 2,2-diethylpropanedioate (PubChem CID 91706029) has the molecular formula C22H33ClO4 and a molecular weight of 396.96 g/mol. Its IUPAC name is 1-O-(2-chloro-5-methylphenyl) 3-O-octyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-(2-chloro-5-methylphenyl) 3-O-octyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91706029 |
| Molecular Formula | C22H33ClO4 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-O-(2-chloro-5-methylphenyl) 3-O-octyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCCCOC(=O)C(CC)(CC)C(=O)Oc1cc(C)ccc1Cl |
| InChI | InChI=1S/C22H33ClO4/c1-5-8-9-10-11-12-15-26-20(24)22(6-2,7-3)21(25)27-19-16-17(4)13-14-18(19)23/h13-14,16H,5-12,15H2,1-4H3 |
| InChIKey | UQWLVXXPANUXOT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|